About [(2S)-3-(6-bromo-1,3-benzoxazol-2-yl)-1-(cyanomethylamino)-1-oxopropan-2-yl]carbamic acid
[(2S)-3-(6-bromo-1,3-benzoxazol-2-yl)-1-(cyanomethylamino)-1-oxopropan-2-yl]carbamic acid (PubChem CID 174159515) has the molecular formula C13H11BrN4O4
and a molecular weight of 367.16 g/mol. Its IUPAC name is [(2S)-3-(6-bromo-1,3-benzoxazol-2-yl)-1-(cyanomethylamino)-1-oxopropan-2-yl]carbamic acid.
Molecular Properties
| Compound Name | [(2S)-3-(6-bromo-1,3-benzoxazol-2-yl)-1-(cyanomethylamino)-1-oxopropan-2-yl]carbamic acid |
| PubChem CID | 174159515 |
| Molecular Formula | C13H11BrN4O4 |
| Molecular Weight | 367.16 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | [(2S)-3-(6-bromo-1,3-benzoxazol-2-yl)-1-(cyanomethylamino)-1-oxopropan-2-yl]carbamic acid |
| SMILES | N#CCNC(=O)[C@H](Cc1nc2ccc(Br)cc2o1)NC(=O)O |
| InChI | InChI=1S/C13H11BrN4O4/c14-7-1-2-8-10(5-7)22-11(17-8)6-9(18-13(20)21)12(19)16-4-3-15/h1-2,5,9,18H,4,6H2,(H,16,19)(H,20,21)/t9-/m0/s1 |
| InChIKey | TXJVGBISXZNZNV-VIFPVBQESA-N |
| XLogP | 1.41 |
| TPSA | 128.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.16 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-3-(6-bromo-1,3-benzoxazol-2-yl)-1-(cyanomethylamino)-1-oxopropan-2-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-3-(6-bromo-1,3-benzoxazol-2-yl)-1-(cyanomethylamino)-1-oxopropan-2-yl]carbamic acid?
The IUPAC name of [(2S)-3-(6-bromo-1,3-benzoxazol-2-yl)-1-(cyanomethylamino)-1-oxopropan-2-yl]carbamic acid (CID 174159515) is [(2S)-3-(6-bromo-1,3-benzoxazol-2-yl)-1-(cyanomethylamino)-1-oxopropan-2-yl]carbamic acid.
What is the SMILES notation for [(2S)-3-(6-bromo-1,3-benzoxazol-2-yl)-1-(cyanomethylamino)-1-oxopropan-2-yl]carbamic acid?
The canonical SMILES for [(2S)-3-(6-bromo-1,3-benzoxazol-2-yl)-1-(cyanomethylamino)-1-oxopropan-2-yl]carbamic acid is N#CCNC(=O)[C@H](Cc1nc2ccc(Br)cc2o1)NC(=O)O.
What is the InChIKey of [(2S)-3-(6-bromo-1,3-benzoxazol-2-yl)-1-(cyanomethylamino)-1-oxopropan-2-yl]carbamic acid?
The InChIKey is TXJVGBISXZNZNV-VIFPVBQESA-N. The full InChI is InChI=1S/C13H11BrN4O4/c14-7-1-2-8-10(5-7)22-11(17-8)6-9(18-13(20)21)12(19)16-4-3-15/h1-2,5,9,18H,4,6H2,(H,16,19)(H,20,21)/t9-/m0/s1.
What are the key properties of [(2S)-3-(6-bromo-1,3-benzoxazol-2-yl)-1-(cyanomethylamino)-1-oxopropan-2-yl]carbamic acid?
[(2S)-3-(6-bromo-1,3-benzoxazol-2-yl)-1-(cyanomethylamino)-1-oxopropan-2-yl]carbamic acid has a molecular weight of 367.16 g/mol, XLogP of 1.41, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-3-(6-bromo-1,3-benzoxazol-2-yl)-1-(cyanomethylamino)-1-oxopropan-2-yl]carbamic acid is sourced from PubChem (CID 174159515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).