About formic acid;1-piperidin-1-ylpiperidine;urea
formic acid;1-piperidin-1-ylpiperidine;urea (PubChem CID 174160275) has the molecular formula C12H26N4O3
and a molecular weight of 274.36 g/mol. Its IUPAC name is formic acid;1-piperidin-1-ylpiperidine;urea.
Molecular Properties
| Compound Name | formic acid;1-piperidin-1-ylpiperidine;urea |
| PubChem CID | 174160275 |
| Molecular Formula | C12H26N4O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | formic acid;1-piperidin-1-ylpiperidine;urea |
| SMILES | C1CCN(N2CCCCC2)CC1.NC(N)=O.O=CO |
| InChI | InChI=1S/C10H20N2.CH4N2O.CH2O2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;2-1(3)4;2-1-3/h1-10H2;(H4,2,3,4);1H,(H,2,3) |
| InChIKey | HCYIJINQKUYHJP-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 112.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;1-piperidin-1-ylpiperidine;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;1-piperidin-1-ylpiperidine;urea?
The IUPAC name of formic acid;1-piperidin-1-ylpiperidine;urea (CID 174160275) is formic acid;1-piperidin-1-ylpiperidine;urea.
What is the SMILES notation for formic acid;1-piperidin-1-ylpiperidine;urea?
The canonical SMILES for formic acid;1-piperidin-1-ylpiperidine;urea is C1CCN(N2CCCCC2)CC1.NC(N)=O.O=CO.
What is the InChIKey of formic acid;1-piperidin-1-ylpiperidine;urea?
The InChIKey is HCYIJINQKUYHJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2.CH4N2O.CH2O2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;2-1(3)4;2-1-3/h1-10H2;(H4,2,3,4);1H,(H,2,3).
What are the key properties of formic acid;1-piperidin-1-ylpiperidine;urea?
formic acid;1-piperidin-1-ylpiperidine;urea has a molecular weight of 274.36 g/mol, XLogP of 0.60, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;1-piperidin-1-ylpiperidine;urea is sourced from PubChem (CID 174160275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).