C16H30Br2O2 — CID 174162240
1-[5,5-dibromo-1-methoxy-2-(methoxymethyl)pentan-2-yl]-3,5-dimethylcyclohexane (PubChem CID 174162240) has the molecular formula C16H30Br2O2 and a molecular weight of 414.22 g/mol. Its IUPAC name is 1-[5,5-dibromo-1-methoxy-2-(methoxymethyl)pentan-2-yl]-3,5-dimethylcyclohexane.
| Compound Name | 1-[5,5-dibromo-1-methoxy-2-(methoxymethyl)pentan-2-yl]-3,5-dimethylcyclohexane |
|---|---|
| PubChem CID | 174162240 |
| Molecular Formula | C16H30Br2O2 |
| Molecular Weight | 414.22 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 1-[5,5-dibromo-1-methoxy-2-(methoxymethyl)pentan-2-yl]-3,5-dimethylcyclohexane |
| SMILES | COCC(CCC(Br)Br)(COC)C1CC(C)CC(C)C1 |
| InChI | InChI=1S/C16H30Br2O2/c1-12-7-13(2)9-14(8-12)16(10-19-3,11-20-4)6-5-15(17)18/h12-15H,5-11H2,1-4H3 |
| InChIKey | JWIAWYUKXYSMPW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.22 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|