C23H22FN3OS — CID 174166478
4-[2-[4-amino-3-[(1-hydroxy-2-methylpropan-2-yl)iminomethyl]phenyl]-5-methylthiophen-3-yl]-2-fluorobenzonitrile (PubChem CID 174166478) has the molecular formula C23H22FN3OS and a molecular weight of 407.51 g/mol. Its IUPAC name is 4-[2-[4-amino-3-[(1-hydroxy-2-methylpropan-2-yl)iminomethyl]phenyl]-5-methylthiophen-3-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[2-[4-amino-3-[(1-hydroxy-2-methylpropan-2-yl)iminomethyl]phenyl]-5-methylthiophen-3-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 174166478 |
| Molecular Formula | C23H22FN3OS |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 4-[2-[4-amino-3-[(1-hydroxy-2-methylpropan-2-yl)iminomethyl]phenyl]-5-methylthiophen-3-yl]-2-fluorobenzonitrile |
| SMILES | Cc1cc(-c2ccc(C#N)c(F)c2)c(-c2ccc(N)c(/C=N/C(C)(C)CO)c2)s1 |
| InChI | InChI=1S/C23H22FN3OS/c1-14-8-19(15-4-5-17(11-25)20(24)10-15)22(29-14)16-6-7-21(26)18(9-16)12-27-23(2,3)13-28/h4-10,12,28H,13,26H2,1-3H3/b27-12+ |
| InChIKey | JSEQNMGZHJLCLJ-KKMKTNMSSA-N |
| XLogP | 5.17 |
| TPSA | 82.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|