C20H16FN3S — CID 174166225
4-[2-[3-amino-4-(methyliminomethyl)phenyl]-5-methylthiophen-3-yl]-2-fluorobenzonitrile (PubChem CID 174166225) has the molecular formula C20H16FN3S and a molecular weight of 349.43 g/mol. Its IUPAC name is 4-[2-[3-amino-4-(methyliminomethyl)phenyl]-5-methylthiophen-3-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[2-[3-amino-4-(methyliminomethyl)phenyl]-5-methylthiophen-3-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 174166225 |
| Molecular Formula | C20H16FN3S |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 4-[2-[3-amino-4-(methyliminomethyl)phenyl]-5-methylthiophen-3-yl]-2-fluorobenzonitrile |
| SMILES | C/N=C/c1ccc(-c2sc(C)cc2-c2ccc(C#N)c(F)c2)cc1N |
| InChI | InChI=1S/C20H16FN3S/c1-12-7-17(13-3-5-15(10-22)18(21)8-13)20(25-12)14-4-6-16(11-24-2)19(23)9-14/h3-9,11H,23H2,1-2H3/b24-11+ |
| InChIKey | HSXAVDBNXFFNIJ-BHGWPJFGSA-N |
| XLogP | 5.03 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|