C21H21FN4 — CID 166907783
4-[(1E,3E)-1-[4-amino-3-(methyliminomethyl)phenyl]-1-(methylamino)penta-1,3-dien-2-yl]-2-fluorobenzonitrile (PubChem CID 166907783) has the molecular formula C21H21FN4 and a molecular weight of 348.43 g/mol. Its IUPAC name is 4-[(1E,3E)-1-[4-amino-3-(methyliminomethyl)phenyl]-1-(methylamino)penta-1,3-dien-2-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[(1E,3E)-1-[4-amino-3-(methyliminomethyl)phenyl]-1-(methylamino)penta-1,3-dien-2-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 166907783 |
| Molecular Formula | C21H21FN4 |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 4-[(1E,3E)-1-[4-amino-3-(methyliminomethyl)phenyl]-1-(methylamino)penta-1,3-dien-2-yl]-2-fluorobenzonitrile |
| SMILES | C/C=C/C(=C(\NC)c1ccc(N)c(/C=N/C)c1)c1ccc(C#N)c(F)c1 |
| InChI | InChI=1S/C21H21FN4/c1-4-5-18(14-6-7-16(12-23)19(22)11-14)21(26-3)15-8-9-20(24)17(10-15)13-25-2/h4-11,13,26H,24H2,1-3H3/b5-4+,21-18+,25-13+ |
| InChIKey | CIXPFRCGBVHZOV-VAABDLFVSA-N |
| XLogP | 3.99 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|