C25H24FN3O2S — CID 174168752
N-[4-amino-5-[4-(4-cyano-3-fluorophenyl)-5-(3-ethenyl-4-hydroxyphenyl)thiophen-2-yl]pentyl]formamide (PubChem CID 174168752) has the molecular formula C25H24FN3O2S and a molecular weight of 449.55 g/mol. Its IUPAC name is N-[4-amino-5-[4-(4-cyano-3-fluorophenyl)-5-(3-ethenyl-4-hydroxyphenyl)thiophen-2-yl]pentyl]formamide.
| Compound Name | N-[4-amino-5-[4-(4-cyano-3-fluorophenyl)-5-(3-ethenyl-4-hydroxyphenyl)thiophen-2-yl]pentyl]formamide |
|---|---|
| PubChem CID | 174168752 |
| Molecular Formula | C25H24FN3O2S |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | N-[4-amino-5-[4-(4-cyano-3-fluorophenyl)-5-(3-ethenyl-4-hydroxyphenyl)thiophen-2-yl]pentyl]formamide |
| SMILES | C=Cc1cc(-c2sc(CC(N)CCCNC=O)cc2-c2ccc(C#N)c(F)c2)ccc1O |
| InChI | InChI=1S/C25H24FN3O2S/c1-2-16-10-18(7-8-24(16)31)25-22(17-5-6-19(14-27)23(26)11-17)13-21(32-25)12-20(28)4-3-9-29-15-30/h2,5-8,10-11,13,15,20,31H,1,3-4,9,12,28H2,(H,29,30) |
| InChIKey | IMLNLKSAASJMOM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 99.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|