C28H31F3N6O2S — CID 174169616
N-[4-amino-5-[5-[5-amino-4-[amino(oxan-3-yl)amino]-2,3-difluorophenyl]-4-(4-cyano-3-fluorophenyl)thiophen-2-yl]pentyl]formamide (PubChem CID 174169616) has the molecular formula C28H31F3N6O2S and a molecular weight of 572.66 g/mol. Its IUPAC name is N-[4-amino-5-[5-[5-amino-4-[amino(oxan-3-yl)amino]-2,3-difluorophenyl]-4-(4-cyano-3-fluorophenyl)thiophen-2-yl]pentyl]formamide.
| Compound Name | N-[4-amino-5-[5-[5-amino-4-[amino(oxan-3-yl)amino]-2,3-difluorophenyl]-4-(4-cyano-3-fluorophenyl)thiophen-2-yl]pentyl]formamide |
|---|---|
| PubChem CID | 174169616 |
| Molecular Formula | C28H31F3N6O2S |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | N-[4-amino-5-[5-[5-amino-4-[amino(oxan-3-yl)amino]-2,3-difluorophenyl]-4-(4-cyano-3-fluorophenyl)thiophen-2-yl]pentyl]formamide |
| SMILES | N#Cc1ccc(-c2cc(CC(N)CCCNC=O)sc2-c2cc(N)c(N(N)C3CCCOC3)c(F)c2F)cc1F |
| InChI | InChI=1S/C28H31F3N6O2S/c29-23-9-16(5-6-17(23)13-32)21-11-20(10-18(33)3-1-7-36-15-38)40-28(21)22-12-24(34)27(26(31)25(22)30)37(35)19-4-2-8-39-14-19/h5-6,9,11-12,15,18-19H,1-4,7-8,10,14,33-35H2,(H,36,38) |
| InChIKey | JHMPHRHUGGCEGC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 143.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|