C27H31N4O2PS — CID 174169002
N-[4-amino-5-[4-(4-cyano-3-phosphanylphenyl)-5-[4-(3-hydroxy-3-methylazetidin-1-yl)phenyl]thiophen-2-yl]pentyl]formamide (PubChem CID 174169002) has the molecular formula C27H31N4O2PS and a molecular weight of 506.61 g/mol. Its IUPAC name is N-[4-amino-5-[4-(4-cyano-3-phosphanylphenyl)-5-[4-(3-hydroxy-3-methylazetidin-1-yl)phenyl]thiophen-2-yl]pentyl]formamide.
| Compound Name | N-[4-amino-5-[4-(4-cyano-3-phosphanylphenyl)-5-[4-(3-hydroxy-3-methylazetidin-1-yl)phenyl]thiophen-2-yl]pentyl]formamide |
|---|---|
| PubChem CID | 174169002 |
| Molecular Formula | C27H31N4O2PS |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | N-[4-amino-5-[4-(4-cyano-3-phosphanylphenyl)-5-[4-(3-hydroxy-3-methylazetidin-1-yl)phenyl]thiophen-2-yl]pentyl]formamide |
| SMILES | CC1(O)CN(c2ccc(-c3sc(CC(N)CCCNC=O)cc3-c3ccc(C#N)c(P)c3)cc2)C1 |
| InChI | InChI=1S/C27H31N4O2PS/c1-27(33)15-31(16-27)22-8-6-18(7-9-22)26-24(19-4-5-20(14-28)25(34)11-19)13-23(35-26)12-21(29)3-2-10-30-17-32/h4-9,11,13,17,21,33H,2-3,10,12,15-16,29,34H2,1H3,(H,30,32) |
| InChIKey | XKNWURUPFXUIGY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 102.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|