C25H26FN7O2 — CID 118979030
2-[(3R,4S)-3-fluoropiperidin-4-yl]oxy-5-[4-[4-(3-hydroxy-3-methylazetidin-1-yl)anilino]-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 118979030) has the molecular formula C25H26FN7O2 and a molecular weight of 475.53 g/mol. Its IUPAC name is 2-[(3R,4S)-3-fluoropiperidin-4-yl]oxy-5-[4-[4-(3-hydroxy-3-methylazetidin-1-yl)anilino]-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-[(3R,4S)-3-fluoropiperidin-4-yl]oxy-5-[4-[4-(3-hydroxy-3-methylazetidin-1-yl)anilino]-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 118979030 |
| Molecular Formula | C25H26FN7O2 |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 2-[(3R,4S)-3-fluoropiperidin-4-yl]oxy-5-[4-[4-(3-hydroxy-3-methylazetidin-1-yl)anilino]-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | CC1(O)CN(c2ccc(Nc3ncnc(-c4ccc(O[C@H]5CCNC[C@H]5F)c(C#N)c4)n3)cc2)C1 |
| InChI | InChI=1S/C25H26FN7O2/c1-25(34)13-33(14-25)19-5-3-18(4-6-19)31-24-30-15-29-23(32-24)16-2-7-21(17(10-16)11-27)35-22-8-9-28-12-20(22)26/h2-7,10,15,20,22,28,34H,8-9,12-14H2,1H3,(H,29,30,31,32)/t20-,22+/m1/s1 |
| InChIKey | ZPIWDHCZOXJDRM-IRLDBZIGSA-N |
| XLogP | 2.80 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|