C21H19N7O2 — CID 118979692
4-[[4-(3-cyano-4-pyrrolidin-3-yloxyphenyl)-1,3,5-triazin-2-yl]amino]benzamide (PubChem CID 118979692) has the molecular formula C21H19N7O2 and a molecular weight of 401.43 g/mol. Its IUPAC name is 4-[[4-(3-cyano-4-pyrrolidin-3-yloxyphenyl)-1,3,5-triazin-2-yl]amino]benzamide.
| Compound Name | 4-[[4-(3-cyano-4-pyrrolidin-3-yloxyphenyl)-1,3,5-triazin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 118979692 |
| Molecular Formula | C21H19N7O2 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 4-[[4-(3-cyano-4-pyrrolidin-3-yloxyphenyl)-1,3,5-triazin-2-yl]amino]benzamide |
| SMILES | N#Cc1cc(-c2ncnc(Nc3ccc(C(N)=O)cc3)n2)ccc1OC1CCNC1 |
| InChI | InChI=1S/C21H19N7O2/c22-10-15-9-14(3-6-18(15)30-17-7-8-24-11-17)20-25-12-26-21(28-20)27-16-4-1-13(2-5-16)19(23)29/h1-6,9,12,17,24H,7-8,11H2,(H2,23,29)(H,25,26,27,28) |
| InChIKey | AXLDUHRMLSPPNF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 138.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |