C29H31FN4O3S — CID 174169290
N-[4-amino-5-[4-(4-cyano-3-fluorophenyl)-5-[2-(2-hydroxy-2-methylpropyl)-1-oxo-3H-isoindol-5-yl]thiophen-2-yl]pentyl]formamide (PubChem CID 174169290) has the molecular formula C29H31FN4O3S and a molecular weight of 534.66 g/mol. Its IUPAC name is N-[4-amino-5-[4-(4-cyano-3-fluorophenyl)-5-[2-(2-hydroxy-2-methylpropyl)-1-oxo-3H-isoindol-5-yl]thiophen-2-yl]pentyl]formamide.
| Compound Name | N-[4-amino-5-[4-(4-cyano-3-fluorophenyl)-5-[2-(2-hydroxy-2-methylpropyl)-1-oxo-3H-isoindol-5-yl]thiophen-2-yl]pentyl]formamide |
|---|---|
| PubChem CID | 174169290 |
| Molecular Formula | C29H31FN4O3S |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | N-[4-amino-5-[4-(4-cyano-3-fluorophenyl)-5-[2-(2-hydroxy-2-methylpropyl)-1-oxo-3H-isoindol-5-yl]thiophen-2-yl]pentyl]formamide |
| SMILES | CC(C)(O)CN1Cc2cc(-c3sc(CC(N)CCCNC=O)cc3-c3ccc(C#N)c(F)c3)ccc2C1=O |
| InChI | InChI=1S/C29H31FN4O3S/c1-29(2,37)16-34-15-21-10-19(7-8-24(21)28(34)36)27-25(18-5-6-20(14-31)26(30)11-18)13-23(38-27)12-22(32)4-3-9-33-17-35/h5-8,10-11,13,17,22,37H,3-4,9,12,15-16,32H2,1-2H3,(H,33,35) |
| InChIKey | QZMFLSOUCXTXNY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 119.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|