C28H30F2N4S — CID 174166039
4-[5-[2-amino-5-(ethenylamino)pentyl]-2-(3-fluoro-4-pyrrolidin-1-ylphenyl)thiophen-3-yl]-2-fluorobenzonitrile (PubChem CID 174166039) has the molecular formula C28H30F2N4S and a molecular weight of 492.64 g/mol. Its IUPAC name is 4-[5-[2-amino-5-(ethenylamino)pentyl]-2-(3-fluoro-4-pyrrolidin-1-ylphenyl)thiophen-3-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[5-[2-amino-5-(ethenylamino)pentyl]-2-(3-fluoro-4-pyrrolidin-1-ylphenyl)thiophen-3-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 174166039 |
| Molecular Formula | C28H30F2N4S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 4-[5-[2-amino-5-(ethenylamino)pentyl]-2-(3-fluoro-4-pyrrolidin-1-ylphenyl)thiophen-3-yl]-2-fluorobenzonitrile |
| SMILES | C=CNCCCC(N)Cc1cc(-c2ccc(C#N)c(F)c2)c(-c2ccc(N3CCCC3)c(F)c2)s1 |
| InChI | InChI=1S/C28H30F2N4S/c1-2-33-11-5-6-22(32)16-23-17-24(19-7-8-21(18-31)25(29)14-19)28(35-23)20-9-10-27(26(30)15-20)34-12-3-4-13-34/h2,7-10,14-15,17,22,33H,1,3-6,11-13,16,32H2 |
| InChIKey | APIKBNJWUCACTR-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 65.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|