About lithium;hydride;phenyl 3-sulfamoyloxypropanoate
lithium;hydride;phenyl 3-sulfamoyloxypropanoate (PubChem CID 174172487) has the molecular formula C9H12LiNO5S
and a molecular weight of 253.20 g/mol. Its IUPAC name is lithium;hydride;phenyl 3-sulfamoyloxypropanoate.
Molecular Properties
| Compound Name | lithium;hydride;phenyl 3-sulfamoyloxypropanoate |
| PubChem CID | 174172487 |
| Molecular Formula | C9H12LiNO5S |
| Molecular Weight | 253.20 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | lithium;hydride;phenyl 3-sulfamoyloxypropanoate |
| SMILES | NS(=O)(=O)OCCC(=O)Oc1ccccc1.[H-].[Li+] |
| InChI | InChI=1S/C9H11NO5S.Li.H/c10-16(12,13)14-7-6-9(11)15-8-4-2-1-3-5-8;;/h1-5H,6-7H2,(H2,10,12,13);;/q;+1;-1 |
| InChIKey | IWSDIUISSOGVRU-UHFFFAOYSA-N |
| XLogP | -2.68 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.20 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze lithium;hydride;phenyl 3-sulfamoyloxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;phenyl 3-sulfamoyloxypropanoate?
The IUPAC name of lithium;hydride;phenyl 3-sulfamoyloxypropanoate (CID 174172487) is lithium;hydride;phenyl 3-sulfamoyloxypropanoate.
What is the SMILES notation for lithium;hydride;phenyl 3-sulfamoyloxypropanoate?
The canonical SMILES for lithium;hydride;phenyl 3-sulfamoyloxypropanoate is NS(=O)(=O)OCCC(=O)Oc1ccccc1.[H-].[Li+].
What is the InChIKey of lithium;hydride;phenyl 3-sulfamoyloxypropanoate?
The InChIKey is IWSDIUISSOGVRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO5S.Li.H/c10-16(12,13)14-7-6-9(11)15-8-4-2-1-3-5-8;;/h1-5H,6-7H2,(H2,10,12,13);;/q;+1;-1.
What are the key properties of lithium;hydride;phenyl 3-sulfamoyloxypropanoate?
lithium;hydride;phenyl 3-sulfamoyloxypropanoate has a molecular weight of 253.20 g/mol, XLogP of -2.68, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;phenyl 3-sulfamoyloxypropanoate is sourced from PubChem (CID 174172487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).