C23H29NO3 — CID 174172510
[(1R)-5-(4-butoxyphenyl)-2,2,6-trimethyl-1,3-dihydroinden-1-yl]carbamic acid (PubChem CID 174172510) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is [(1R)-5-(4-butoxyphenyl)-2,2,6-trimethyl-1,3-dihydroinden-1-yl]carbamic acid.
| Compound Name | [(1R)-5-(4-butoxyphenyl)-2,2,6-trimethyl-1,3-dihydroinden-1-yl]carbamic acid |
|---|---|
| PubChem CID | 174172510 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | [(1R)-5-(4-butoxyphenyl)-2,2,6-trimethyl-1,3-dihydroinden-1-yl]carbamic acid |
| SMILES | CCCCOc1ccc(-c2cc3c(cc2C)[C@H](NC(=O)O)C(C)(C)C3)cc1 |
| InChI | InChI=1S/C23H29NO3/c1-5-6-11-27-18-9-7-16(8-10-18)19-13-17-14-23(3,4)21(24-22(25)26)20(17)12-15(19)2/h7-10,12-13,21,24H,5-6,11,14H2,1-4H3,(H,25,26)/t21-/m0/s1 |
| InChIKey | MMVBPUIJRSNZTN-NRFANRHFSA-N |
| XLogP | 5.73 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|