C15H33NO — CID 174180285
N,3-dimethyl-N-(2,2,4-trimethylhexoxy)butan-1-amine (PubChem CID 174180285) has the molecular formula C15H33NO and a molecular weight of 243.43 g/mol. Its IUPAC name is N,3-dimethyl-N-(2,2,4-trimethylhexoxy)butan-1-amine.
| Compound Name | N,3-dimethyl-N-(2,2,4-trimethylhexoxy)butan-1-amine |
|---|---|
| PubChem CID | 174180285 |
| Molecular Formula | C15H33NO |
| Molecular Weight | 243.43 g/mol |
| Exact Mass | 243.26 |
| IUPAC Name | N,3-dimethyl-N-(2,2,4-trimethylhexoxy)butan-1-amine |
| SMILES | CCC(C)CC(C)(C)CON(C)CCC(C)C |
| InChI | InChI=1S/C15H33NO/c1-8-14(4)11-15(5,6)12-17-16(7)10-9-13(2)3/h13-14H,8-12H2,1-7H3 |
| InChIKey | WPMDRHAWCLUSLQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|