C33H30Cl2O4 — CID 174182819
[6-benzoyloxy-3-[(1Z)-buta-1,3-dienyl]-4-(chloromethyl)-5-(2-chloro-6-methylphenyl)-2-methylcyclohex-3-en-1-yl] benzoate (PubChem CID 174182819) has the molecular formula C33H30Cl2O4 and a molecular weight of 561.51 g/mol. Its IUPAC name is [6-benzoyloxy-3-[(1Z)-buta-1,3-dienyl]-4-(chloromethyl)-5-(2-chloro-6-methylphenyl)-2-methylcyclohex-3-en-1-yl] benzoate.
| Compound Name | [6-benzoyloxy-3-[(1Z)-buta-1,3-dienyl]-4-(chloromethyl)-5-(2-chloro-6-methylphenyl)-2-methylcyclohex-3-en-1-yl] benzoate |
|---|---|
| PubChem CID | 174182819 |
| Molecular Formula | C33H30Cl2O4 |
| Molecular Weight | 561.51 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | [6-benzoyloxy-3-[(1Z)-buta-1,3-dienyl]-4-(chloromethyl)-5-(2-chloro-6-methylphenyl)-2-methylcyclohex-3-en-1-yl] benzoate |
| SMILES | C=C/C=C\C1=C(CCl)C(c2c(C)cccc2Cl)C(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1C |
| InChI | InChI=1S/C33H30Cl2O4/c1-4-5-18-25-22(3)30(38-32(36)23-14-8-6-9-15-23)31(39-33(37)24-16-10-7-11-17-24)29(26(25)20-34)28-21(2)13-12-19-27(28)35/h4-19,22,29-31H,1,20H2,2-3H3/b18-5- |
| InChIKey | XHNUZCLMZYMAOJ-DVZOWYKESA-N |
| XLogP | 8.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.51 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|