About 2-(azepan-1-yl)ethyl 3-[bis(2-hydroxyethyl)amino]propanoate;prop-2-enoyl chloride
2-(azepan-1-yl)ethyl 3-[bis(2-hydroxyethyl)amino]propanoate;prop-2-enoyl chloride (PubChem CID 174185931) has the molecular formula C18H33ClN2O5
and a molecular weight of 392.92 g/mol. Its IUPAC name is 2-(azepan-1-yl)ethyl 3-[bis(2-hydroxyethyl)amino]propanoate;prop-2-enoyl chloride.
Molecular Properties
| Compound Name | 2-(azepan-1-yl)ethyl 3-[bis(2-hydroxyethyl)amino]propanoate;prop-2-enoyl chloride |
| PubChem CID | 174185931 |
| Molecular Formula | C18H33ClN2O5 |
| Molecular Weight | 392.92 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 2-(azepan-1-yl)ethyl 3-[bis(2-hydroxyethyl)amino]propanoate;prop-2-enoyl chloride |
| SMILES | C=CC(=O)Cl.O=C(CCN(CCO)CCO)OCCN1CCCCCC1 |
| InChI | InChI=1S/C15H30N2O4.C3H3ClO/c18-12-9-17(10-13-19)8-5-15(20)21-14-11-16-6-3-1-2-4-7-16;1-2-3(4)5/h18-19H,1-14H2;2H,1H2 |
| InChIKey | UXRYYSYYYQKANE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.92 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(azepan-1-yl)ethyl 3-[bis(2-hydroxyethyl)amino]propanoate;prop-2-enoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azepan-1-yl)ethyl 3-[bis(2-hydroxyethyl)amino]propanoate;prop-2-enoyl chloride?
The IUPAC name of 2-(azepan-1-yl)ethyl 3-[bis(2-hydroxyethyl)amino]propanoate;prop-2-enoyl chloride (CID 174185931) is 2-(azepan-1-yl)ethyl 3-[bis(2-hydroxyethyl)amino]propanoate;prop-2-enoyl chloride.
What is the SMILES notation for 2-(azepan-1-yl)ethyl 3-[bis(2-hydroxyethyl)amino]propanoate;prop-2-enoyl chloride?
The canonical SMILES for 2-(azepan-1-yl)ethyl 3-[bis(2-hydroxyethyl)amino]propanoate;prop-2-enoyl chloride is C=CC(=O)Cl.O=C(CCN(CCO)CCO)OCCN1CCCCCC1.
What is the InChIKey of 2-(azepan-1-yl)ethyl 3-[bis(2-hydroxyethyl)amino]propanoate;prop-2-enoyl chloride?
The InChIKey is UXRYYSYYYQKANE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O4.C3H3ClO/c18-12-9-17(10-13-19)8-5-15(20)21-14-11-16-6-3-1-2-4-7-16;1-2-3(4)5/h18-19H,1-14H2;2H,1H2.
What are the key properties of 2-(azepan-1-yl)ethyl 3-[bis(2-hydroxyethyl)amino]propanoate;prop-2-enoyl chloride?
2-(azepan-1-yl)ethyl 3-[bis(2-hydroxyethyl)amino]propanoate;prop-2-enoyl chloride has a molecular weight of 392.92 g/mol, XLogP of 1.02, 11 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azepan-1-yl)ethyl 3-[bis(2-hydroxyethyl)amino]propanoate;prop-2-enoyl chloride is sourced from PubChem (CID 174185931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).