C11H25ClN2O4 — CID 89232161
2-[3-[bis(2-hydroxyethyl)amino]propanoyloxy]ethyl-dimethylazanium chloride (PubChem CID 89232161) has the molecular formula C11H25ClN2O4 and a molecular weight of 284.78 g/mol. Its IUPAC name is 2-[3-[bis(2-hydroxyethyl)amino]propanoyloxy]ethyl-dimethylazanium chloride.
| Compound Name | 2-[3-[bis(2-hydroxyethyl)amino]propanoyloxy]ethyl-dimethylazanium chloride |
|---|---|
| PubChem CID | 89232161 |
| Molecular Formula | C11H25ClN2O4 |
| Molecular Weight | 284.78 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 2-[3-[bis(2-hydroxyethyl)amino]propanoyloxy]ethyl-dimethylazanium chloride |
| SMILES | C[NH+](C)CCOC(=O)CCN(CCO)CCO.[Cl-] |
| InChI | InChI=1S/C11H24N2O4.ClH/c1-12(2)7-10-17-11(16)3-4-13(5-8-14)6-9-15;/h14-15H,3-10H2,1-2H3;1H |
| InChIKey | FVFFGPXDCDJHSM-UHFFFAOYSA-N |
| XLogP | -5.65 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.78 |
| LogP ≤ 5 | -5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |