C16H32O3Si — CID 174205697
3-[(2-methylpropan-2-yl)oxysilyl]octyl 2-methylprop-2-enoate (PubChem CID 174205697) has the molecular formula C16H32O3Si and a molecular weight of 300.52 g/mol. Its IUPAC name is 3-[(2-methylpropan-2-yl)oxysilyl]octyl 2-methylprop-2-enoate.
| Compound Name | 3-[(2-methylpropan-2-yl)oxysilyl]octyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174205697 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.52 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 3-[(2-methylpropan-2-yl)oxysilyl]octyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(CCCCC)[SiH2]OC(C)(C)C |
| InChI | InChI=1S/C16H32O3Si/c1-7-8-9-10-14(20-19-16(4,5)6)11-12-18-15(17)13(2)3/h14H,2,7-12,20H2,1,3-6H3 |
| InChIKey | QXPTWYTVUSEJBI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|