C26H26ClF2N5O3 — CID 174207307
3-[[4-[5-chloro-2-(5,5-difluoropiperidin-3-yl)oxy-3-methylphenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 174207307) has the molecular formula C26H26ClF2N5O3 and a molecular weight of 529.98 g/mol. Its IUPAC name is 3-[[4-[5-chloro-2-(5,5-difluoropiperidin-3-yl)oxy-3-methylphenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 3-[[4-[5-chloro-2-(5,5-difluoropiperidin-3-yl)oxy-3-methylphenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 174207307 |
| Molecular Formula | C26H26ClF2N5O3 |
| Molecular Weight | 529.98 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | 3-[[4-[5-chloro-2-(5,5-difluoropiperidin-3-yl)oxy-3-methylphenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | Cc1cc(Cl)cc(-c2ncnn3cc(CN4C(=O)C5C(C4=O)C5(C)C)cc23)c1OC1CNCC(F)(F)C1 |
| InChI | InChI=1S/C26H26ClF2N5O3/c1-13-4-15(27)6-17(22(13)37-16-7-26(28,29)11-30-8-16)21-18-5-14(10-34(18)32-12-31-21)9-33-23(35)19-20(24(33)36)25(19,2)3/h4-6,10,12,16,19-20,30H,7-9,11H2,1-3H3 |
| InChIKey | IGKSXLWKFDLICH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.98 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|