C16H13ClN4O3 — CID 174218490
5-(1-carbamoyl-6-chloro-4-phenylcyclohexa-2,4-dien-1-yl)-2H-triazole-4-carboxylic acid (PubChem CID 174218490) has the molecular formula C16H13ClN4O3 and a molecular weight of 344.76 g/mol. Its IUPAC name is 5-(1-carbamoyl-6-chloro-4-phenylcyclohexa-2,4-dien-1-yl)-2H-triazole-4-carboxylic acid.
| Compound Name | 5-(1-carbamoyl-6-chloro-4-phenylcyclohexa-2,4-dien-1-yl)-2H-triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 174218490 |
| Molecular Formula | C16H13ClN4O3 |
| Molecular Weight | 344.76 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 5-(1-carbamoyl-6-chloro-4-phenylcyclohexa-2,4-dien-1-yl)-2H-triazole-4-carboxylic acid |
| SMILES | NC(=O)C1(c2n[nH]nc2C(=O)O)C=CC(c2ccccc2)=CC1Cl |
| InChI | InChI=1S/C16H13ClN4O3/c17-11-8-10(9-4-2-1-3-5-9)6-7-16(11,15(18)24)13-12(14(22)23)19-21-20-13/h1-8,11H,(H2,18,24)(H,22,23)(H,19,20,21) |
| InChIKey | MEKGDHMRZTWNAU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.76 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|