C18H14ClF3N6O — CID 174222128
1-[3-chloro-4-(trifluoromethyl)phenyl]-3-[1-(3-pyrimidin-2-ylpyrazin-2-yl)ethyl]urea (PubChem CID 174222128) has the molecular formula C18H14ClF3N6O and a molecular weight of 422.80 g/mol. Its IUPAC name is 1-[3-chloro-4-(trifluoromethyl)phenyl]-3-[1-(3-pyrimidin-2-ylpyrazin-2-yl)ethyl]urea.
| Compound Name | 1-[3-chloro-4-(trifluoromethyl)phenyl]-3-[1-(3-pyrimidin-2-ylpyrazin-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 174222128 |
| Molecular Formula | C18H14ClF3N6O |
| Molecular Weight | 422.80 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 1-[3-chloro-4-(trifluoromethyl)phenyl]-3-[1-(3-pyrimidin-2-ylpyrazin-2-yl)ethyl]urea |
| SMILES | CC(NC(=O)Nc1ccc(C(F)(F)F)c(Cl)c1)c1nccnc1-c1ncccn1 |
| InChI | InChI=1S/C18H14ClF3N6O/c1-10(14-15(24-8-7-23-14)16-25-5-2-6-26-16)27-17(29)28-11-3-4-12(13(19)9-11)18(20,21)22/h2-10H,1H3,(H2,27,28,29) |
| InChIKey | BISZDETWOPCFGW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.80 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |