C32H29N5O4+2 — CID 174224400
2-amino-1-N,4-N-bis[4-(1-methylpyridin-1-ium-4-yl)oxyphenyl]benzene-1,4-dicarboxamide (PubChem CID 174224400) has the molecular formula C32H29N5O4+2 and a molecular weight of 547.62 g/mol. Its IUPAC name is 2-amino-1-N,4-N-bis[4-(1-methylpyridin-1-ium-4-yl)oxyphenyl]benzene-1,4-dicarboxamide.
| Compound Name | 2-amino-1-N,4-N-bis[4-(1-methylpyridin-1-ium-4-yl)oxyphenyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 174224400 |
| Molecular Formula | C32H29N5O4+2 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | 2-amino-1-N,4-N-bis[4-(1-methylpyridin-1-ium-4-yl)oxyphenyl]benzene-1,4-dicarboxamide |
| SMILES | C[n+]1ccc(Oc2ccc(NC(=O)c3ccc(C(=O)Nc4ccc(Oc5cc[n+](C)cc5)cc4)c(N)c3)cc2)cc1 |
| InChI | InChI=1S/C32H27N5O4/c1-36-17-13-27(14-18-36)40-25-8-4-23(5-9-25)34-31(38)22-3-12-29(30(33)21-22)32(39)35-24-6-10-26(11-7-24)41-28-15-19-37(2)20-16-28/h3-21H,1-2H3,(H2-2,33,34,35,38,39)/p+2 |
| InChIKey | VVOPAZKXZHWHAK-UHFFFAOYSA-P |
| XLogP | 5.01 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|