C36H37N9O4+2 — CID 87513656
2-amino-1-N,4-N-bis[2-amino-4-[(1-ethylpyridin-1-ium-3-yl)carbamoyl]phenyl]benzene-1,4-dicarboxamide (PubChem CID 87513656) has the molecular formula C36H37N9O4+2 and a molecular weight of 659.75 g/mol. Its IUPAC name is 2-amino-1-N,4-N-bis[2-amino-4-[(1-ethylpyridin-1-ium-3-yl)carbamoyl]phenyl]benzene-1,4-dicarboxamide.
| Compound Name | 2-amino-1-N,4-N-bis[2-amino-4-[(1-ethylpyridin-1-ium-3-yl)carbamoyl]phenyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 87513656 |
| Molecular Formula | C36H37N9O4+2 |
| Molecular Weight | 659.75 g/mol |
| Exact Mass | 659.30 |
| IUPAC Name | 2-amino-1-N,4-N-bis[2-amino-4-[(1-ethylpyridin-1-ium-3-yl)carbamoyl]phenyl]benzene-1,4-dicarboxamide |
| SMILES | CC[n+]1cccc(NC(=O)c2ccc(NC(=O)c3ccc(C(=O)Nc4ccc(C(=O)Nc5ccc[n+](CC)c5)cc4N)c(N)c3)c(N)c2)c1 |
| InChI | InChI=1S/C36H35N9O4/c1-3-44-15-5-7-25(20-44)40-33(46)23-10-13-31(29(38)18-23)42-35(48)22-9-12-27(28(37)17-22)36(49)43-32-14-11-24(19-30(32)39)34(47)41-26-8-6-16-45(4-2)21-26/h5-21H,3-4H2,1-2H3,(H8-2,37,38,39,40,41,42,43,46,47,48,49)/p+2 |
| InChIKey | SYUFPZPUSOJNSE-UHFFFAOYSA-P |
| XLogP | 4.06 |
| TPSA | 202.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.75 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|