C15H20F3NO2 — CID 174225094
cis-(1R,3R)-3-benzylcyclohexan-1-amine;2,2,2-trifluoroacetic acid (PubChem CID 174225094) has the molecular formula C15H20F3NO2 and a molecular weight of 303.32 g/mol. Its IUPAC name is cis-(1R,3R)-3-benzylcyclohexan-1-amine;2,2,2-trifluoroacetic acid.
| Compound Name | cis-(1R,3R)-3-benzylcyclohexan-1-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 174225094 |
| Molecular Formula | C15H20F3NO2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | cis-(1R,3R)-3-benzylcyclohexan-1-amine;2,2,2-trifluoroacetic acid |
| SMILES | N[C@@H]1CCC[C@H](Cc2ccccc2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H19N.C2HF3O2/c14-13-8-4-7-12(10-13)9-11-5-2-1-3-6-11;3-2(4,5)1(6)7/h1-3,5-6,12-13H,4,7-10,14H2;(H,6,7)/t12-,13-;/m1./s1 |
| InChIKey | XATWDTOJUKTHQD-OJERSXHUSA-N |
| XLogP | 3.38 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |