C15H27N3O4 — CID 174228292
3-amino-4-[1-[(2,6-dimethylcyclohexyl)-formylamino]ethylamino]-4-oxobutanoic acid (PubChem CID 174228292) has the molecular formula C15H27N3O4 and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-amino-4-[1-[(2,6-dimethylcyclohexyl)-formylamino]ethylamino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[1-[(2,6-dimethylcyclohexyl)-formylamino]ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 174228292 |
| Molecular Formula | C15H27N3O4 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 3-amino-4-[1-[(2,6-dimethylcyclohexyl)-formylamino]ethylamino]-4-oxobutanoic acid |
| SMILES | CC1CCCC(C)C1N(C=O)C(C)NC(=O)C(N)CC(=O)O |
| InChI | InChI=1S/C15H27N3O4/c1-9-5-4-6-10(2)14(9)18(8-19)11(3)17-15(22)12(16)7-13(20)21/h8-12,14H,4-7,16H2,1-3H3,(H,17,22)(H,20,21) |
| InChIKey | ZZIRNQLYKLEIFC-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|