C18H12F3N3O2S — CID 174239516
N-(thiophen-2-ylmethylideneamino)-4-[4-(trifluoromethoxy)phenyl]pyridine-2-carboxamide (PubChem CID 174239516) has the molecular formula C18H12F3N3O2S and a molecular weight of 391.37 g/mol. Its IUPAC name is N-(thiophen-2-ylmethylideneamino)-4-[4-(trifluoromethoxy)phenyl]pyridine-2-carboxamide.
| Compound Name | N-(thiophen-2-ylmethylideneamino)-4-[4-(trifluoromethoxy)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 174239516 |
| Molecular Formula | C18H12F3N3O2S |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | N-(thiophen-2-ylmethylideneamino)-4-[4-(trifluoromethoxy)phenyl]pyridine-2-carboxamide |
| SMILES | O=C(NN=Cc1cccs1)c1cc(-c2ccc(OC(F)(F)F)cc2)ccn1 |
| InChI | InChI=1S/C18H12F3N3O2S/c19-18(20,21)26-14-5-3-12(4-6-14)13-7-8-22-16(10-13)17(25)24-23-11-15-2-1-9-27-15/h1-11H,(H,24,25) |
| InChIKey | SKARCCDQINCQEG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|