C28H24F5N6O3S- — CID 174239698
2-[[5-(difluoromethyl)piperidin-3-yl]amino]-4-[2-[2,3,5-trifluoro-4-[phenyl-(sulfinatoamino)methyl]phenoxy]-3-pyridinyl]pyrimidine (PubChem CID 174239698) has the molecular formula C28H24F5N6O3S- and a molecular weight of 619.60 g/mol. Its IUPAC name is 2-[[5-(difluoromethyl)piperidin-3-yl]amino]-4-[2-[2,3,5-trifluoro-4-[phenyl-(sulfinatoamino)methyl]phenoxy]-3-pyridinyl]pyrimidine.
| Compound Name | 2-[[5-(difluoromethyl)piperidin-3-yl]amino]-4-[2-[2,3,5-trifluoro-4-[phenyl-(sulfinatoamino)methyl]phenoxy]-3-pyridinyl]pyrimidine |
|---|---|
| PubChem CID | 174239698 |
| Molecular Formula | C28H24F5N6O3S- |
| Molecular Weight | 619.60 g/mol |
| Exact Mass | 619.16 |
| IUPAC Name | 2-[[5-(difluoromethyl)piperidin-3-yl]amino]-4-[2-[2,3,5-trifluoro-4-[phenyl-(sulfinatoamino)methyl]phenoxy]-3-pyridinyl]pyrimidine |
| SMILES | O=S([O-])NC(c1ccccc1)c1c(F)cc(Oc2ncccc2-c2ccnc(NC3CNCC(C(F)F)C3)n2)c(F)c1F |
| InChI | InChI=1S/C28H25F5N6O3S/c29-19-12-21(23(30)24(31)22(19)25(39-43(40)41)15-5-2-1-3-6-15)42-27-18(7-4-9-35-27)20-8-10-36-28(38-20)37-17-11-16(26(32)33)13-34-14-17/h1-10,12,16-17,25-26,34,39H,11,13-14H2,(H,40,41)(H,36,37,38)/p-1 |
| InChIKey | OUNGUJHHFFQMBM-UHFFFAOYSA-M |
| XLogP | 4.88 |
| TPSA | 124.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|