C27H23F2N6O4S- — CID 174239736
4-[2-[2,3-difluoro-4-[(S)-phenyl-(sulfinatoamino)methyl]phenoxy]-3-pyridinyl]-2-[[(3S)-6-oxopiperidin-3-yl]amino]pyrimidine (PubChem CID 174239736) has the molecular formula C27H23F2N6O4S- and a molecular weight of 565.58 g/mol. Its IUPAC name is 4-[2-[2,3-difluoro-4-[(S)-phenyl-(sulfinatoamino)methyl]phenoxy]-3-pyridinyl]-2-[[(3S)-6-oxopiperidin-3-yl]amino]pyrimidine.
| Compound Name | 4-[2-[2,3-difluoro-4-[(S)-phenyl-(sulfinatoamino)methyl]phenoxy]-3-pyridinyl]-2-[[(3S)-6-oxopiperidin-3-yl]amino]pyrimidine |
|---|---|
| PubChem CID | 174239736 |
| Molecular Formula | C27H23F2N6O4S- |
| Molecular Weight | 565.58 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | 4-[2-[2,3-difluoro-4-[(S)-phenyl-(sulfinatoamino)methyl]phenoxy]-3-pyridinyl]-2-[[(3S)-6-oxopiperidin-3-yl]amino]pyrimidine |
| SMILES | O=C1CC[C@H](Nc2nccc(-c3cccnc3Oc3ccc([C@@H](NS(=O)[O-])c4ccccc4)c(F)c3F)n2)CN1 |
| InChI | InChI=1S/C27H24F2N6O4S/c28-23-19(25(35-40(37)38)16-5-2-1-3-6-16)9-10-21(24(23)29)39-26-18(7-4-13-30-26)20-12-14-31-27(34-20)33-17-8-11-22(36)32-15-17/h1-7,9-10,12-14,17,25,35H,8,11,15H2,(H,32,36)(H,37,38)(H,31,33,34)/p-1/t17-,25-/m0/s1 |
| InChIKey | LKTIBWLENKRALT-GKVSMKOHSA-M |
| XLogP | 3.77 |
| TPSA | 141.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.58 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|