C15H16F3N3O6 — CID 174241392
[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]carbamoyl 2,2,2-trifluoroacetate (PubChem CID 174241392) has the molecular formula C15H16F3N3O6 and a molecular weight of 391.30 g/mol. Its IUPAC name is [[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]carbamoyl 2,2,2-trifluoroacetate.
| Compound Name | [[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]carbamoyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 174241392 |
| Molecular Formula | C15H16F3N3O6 |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | [[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]carbamoyl 2,2,2-trifluoroacetate |
| SMILES | O=C(NNC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C15H16F3N3O6/c16-15(17,18)13(25)27-14(26)20-19-12(24)9-3-1-8(2-4-9)7-21-10(22)5-6-11(21)23/h5-6,8-9H,1-4,7H2,(H,19,24)(H,20,26) |
| InChIKey | LQLBQCJINWQKGT-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|