C15H20F3N3O4 — CID 91069004
4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carbohydrazide;1,1,1-trifluoropropan-2-one (PubChem CID 91069004) has the molecular formula C15H20F3N3O4 and a molecular weight of 363.34 g/mol. Its IUPAC name is 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carbohydrazide;1,1,1-trifluoropropan-2-one.
| Compound Name | 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carbohydrazide;1,1,1-trifluoropropan-2-one |
|---|---|
| PubChem CID | 91069004 |
| Molecular Formula | C15H20F3N3O4 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carbohydrazide;1,1,1-trifluoropropan-2-one |
| SMILES | CC(=O)C(F)(F)F.NNC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C12H17N3O3.C3H3F3O/c13-14-12(18)9-3-1-8(2-4-9)7-15-10(16)5-6-11(15)17;1-2(7)3(4,5)6/h5-6,8-9H,1-4,7,13H2,(H,14,18);1H3 |
| InChIKey | NMTQTHDOACZYRP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|