C12H19Cl2N3O3 — CID 66688235
4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carbohydrazide;dihydrochloride (PubChem CID 66688235) has the molecular formula C12H19Cl2N3O3 and a molecular weight of 324.21 g/mol. Its IUPAC name is 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carbohydrazide;dihydrochloride.
| Compound Name | 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carbohydrazide;dihydrochloride |
|---|---|
| PubChem CID | 66688235 |
| Molecular Formula | C12H19Cl2N3O3 |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carbohydrazide;dihydrochloride |
| SMILES | Cl.Cl.NNC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C12H17N3O3.2ClH/c13-14-12(18)9-3-1-8(2-4-9)7-15-10(16)5-6-11(15)17;;/h5-6,8-9H,1-4,7,13H2,(H,14,18);2*1H |
| InChIKey | IXEORJVJJWQUDZ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|