C13H20N3O3+ — CID 59266690
[[2-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]acetyl]amino]azanium (PubChem CID 59266690) has the molecular formula C13H20N3O3+ and a molecular weight of 266.32 g/mol. Its IUPAC name is [[2-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]acetyl]amino]azanium.
| Compound Name | [[2-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]acetyl]amino]azanium |
|---|---|
| PubChem CID | 59266690 |
| Molecular Formula | C13H20N3O3+ |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | [[2-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]acetyl]amino]azanium |
| SMILES | [NH3+]NC(=O)CC1CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C13H19N3O3/c14-15-11(17)7-9-1-3-10(4-2-9)8-16-12(18)5-6-13(16)19/h5-6,9-10H,1-4,7-8,14H2,(H,15,17)/p+1 |
| InChIKey | GRWUISTXZVXZMF-UHFFFAOYSA-O |
| XLogP | -0.62 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|