C16H42NO4Si3+ — CID 174243559
diethyl-[2-hydroxy-3-[[methyl-bis(trimethylsilyloxy)silyl]methoxy]propyl]-methylazanium (PubChem CID 174243559) has the molecular formula C16H42NO4Si3+ and a molecular weight of 396.77 g/mol. Its IUPAC name is diethyl-[2-hydroxy-3-[[methyl-bis(trimethylsilyloxy)silyl]methoxy]propyl]-methylazanium.
| Compound Name | diethyl-[2-hydroxy-3-[[methyl-bis(trimethylsilyloxy)silyl]methoxy]propyl]-methylazanium |
|---|---|
| PubChem CID | 174243559 |
| Molecular Formula | C16H42NO4Si3+ |
| Molecular Weight | 396.77 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | diethyl-[2-hydroxy-3-[[methyl-bis(trimethylsilyloxy)silyl]methoxy]propyl]-methylazanium |
| SMILES | CC[N+](C)(CC)CC(O)COC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H42NO4Si3/c1-11-17(3,12-2)13-16(18)14-19-15-24(10,20-22(4,5)6)21-23(7,8)9/h16,18H,11-15H2,1-10H3/q+1 |
| InChIKey | UUZKWDYMTFJCEU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.77 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|