C15H40O10Si3 — CID 91232678
1-[[[dimethyl(trimethylsilyloxy)silyl]oxy-dihydroxysilyl]methoxy]-3-(ethoxymethoxy)propan-2-ol;ethoxymethanol (PubChem CID 91232678) has the molecular formula C15H40O10Si3 and a molecular weight of 464.73 g/mol. Its IUPAC name is 1-[[[dimethyl(trimethylsilyloxy)silyl]oxy-dihydroxysilyl]methoxy]-3-(ethoxymethoxy)propan-2-ol;ethoxymethanol.
| Compound Name | 1-[[[dimethyl(trimethylsilyloxy)silyl]oxy-dihydroxysilyl]methoxy]-3-(ethoxymethoxy)propan-2-ol;ethoxymethanol |
|---|---|
| PubChem CID | 91232678 |
| Molecular Formula | C15H40O10Si3 |
| Molecular Weight | 464.73 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 1-[[[dimethyl(trimethylsilyloxy)silyl]oxy-dihydroxysilyl]methoxy]-3-(ethoxymethoxy)propan-2-ol;ethoxymethanol |
| SMILES | CCOCO.CCOCOCC(O)COC[Si](O)(O)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C12H32O8Si3.C3H8O2/c1-7-16-10-17-8-12(13)9-18-11-23(14,15)20-22(5,6)19-21(2,3)4;1-2-5-3-4/h12-15H,7-11H2,1-6H3;4H,2-3H2,1H3 |
| InChIKey | ZSBOLBZIUOPIBA-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.73 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|