C25H18N2O2 — CID 174243858
1-(4-methylphenyl)-3,5-bis(4-nitrosophenyl)benzene (PubChem CID 174243858) has the molecular formula C25H18N2O2 and a molecular weight of 378.43 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3,5-bis(4-nitrosophenyl)benzene.
| Compound Name | 1-(4-methylphenyl)-3,5-bis(4-nitrosophenyl)benzene |
|---|---|
| PubChem CID | 174243858 |
| Molecular Formula | C25H18N2O2 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 1-(4-methylphenyl)-3,5-bis(4-nitrosophenyl)benzene |
| SMILES | Cc1ccc(-c2cc(-c3ccc(N=O)cc3)cc(-c3ccc(N=O)cc3)c2)cc1 |
| InChI | InChI=1S/C25H18N2O2/c1-17-2-4-18(5-3-17)21-14-22(19-6-10-24(26-28)11-7-19)16-23(15-21)20-8-12-25(27-29)13-9-20/h2-16H,1H3 |
| InChIKey | BLNIPGMNEAHNKA-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |