C26H16N2O2 — CID 174243904
2,6-bis(4-nitrosophenyl)anthracene (PubChem CID 174243904) has the molecular formula C26H16N2O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is 2,6-bis(4-nitrosophenyl)anthracene.
| Compound Name | 2,6-bis(4-nitrosophenyl)anthracene |
|---|---|
| PubChem CID | 174243904 |
| Molecular Formula | C26H16N2O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 2,6-bis(4-nitrosophenyl)anthracene |
| SMILES | O=Nc1ccc(-c2ccc3cc4cc(-c5ccc(N=O)cc5)ccc4cc3c2)cc1 |
| InChI | InChI=1S/C26H16N2O2/c29-27-25-9-5-17(6-10-25)19-1-3-21-15-24-14-20(2-4-22(24)16-23(21)13-19)18-7-11-26(28-30)12-8-18/h1-16H |
| InChIKey | SSGRWTUSFKUAME-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|