C11H23BO4S — CID 174245537
4,4,5,5-tetramethyl-2-[(2R)-3-methylsulfonylbutan-2-yl]-1,3,2-dioxaborolane (PubChem CID 174245537) has the molecular formula C11H23BO4S and a molecular weight of 262.18 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(2R)-3-methylsulfonylbutan-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(2R)-3-methylsulfonylbutan-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 174245537 |
| Molecular Formula | C11H23BO4S |
| Molecular Weight | 262.18 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(2R)-3-methylsulfonylbutan-2-yl]-1,3,2-dioxaborolane |
| SMILES | CC([C@@H](C)B1OC(C)(C)C(C)(C)O1)S(C)(=O)=O |
| InChI | InChI=1S/C11H23BO4S/c1-8(9(2)17(7,13)14)12-15-10(3,4)11(5,6)16-12/h8-9H,1-7H3/t8-,9?/m1/s1 |
| InChIKey | QAQDFKUIKPGFDC-VEDVMXKPSA-N |
| XLogP | 1.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.18 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|