C10H22BNO2 — CID 154475486
(3S)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-amine (PubChem CID 154475486) has the molecular formula C10H22BNO2 and a molecular weight of 199.10 g/mol. Its IUPAC name is (3S)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-amine.
| Compound Name | (3S)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-amine |
|---|---|
| PubChem CID | 154475486 |
| Molecular Formula | C10H22BNO2 |
| Molecular Weight | 199.10 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | (3S)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-amine |
| SMILES | CC(N)[C@H](C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C10H22BNO2/c1-7(8(2)12)11-13-9(3,4)10(5,6)14-11/h7-8H,12H2,1-6H3/t7-,8?/m0/s1 |
| InChIKey | YVKDEEXHJUHCFR-JAMMHHFISA-N |
| XLogP | 1.82 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.10 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|