C32H22BF7O2 — CID 174245870
2-[6-[3-(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)phenyl]naphthalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 174245870) has the molecular formula C32H22BF7O2 and a molecular weight of 582.32 g/mol. Its IUPAC name is 2-[6-[3-(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)phenyl]naphthalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[6-[3-(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)phenyl]naphthalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 174245870 |
| Molecular Formula | C32H22BF7O2 |
| Molecular Weight | 582.32 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | 2-[6-[3-(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)phenyl]naphthalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc3cc(-c4cccc(-c5c(F)c(F)c(F)c6c(F)c(F)c(F)c(F)c56)c4)ccc3c2)OC1(C)C |
| InChI | InChI=1S/C32H22BF7O2/c1-31(2)32(3,4)42-33(41-31)20-11-10-17-12-16(8-9-18(17)14-20)15-6-5-7-19(13-15)21-22-23(26(36)28(38)24(21)34)27(37)30(40)29(39)25(22)35/h5-14H,1-4H3 |
| InChIKey | CWYIJRNXJUHLOW-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.32 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|