C11H10Zr — CID 174248756
benzene;cyclopenta-1,3-diene;zirconium(2+) (PubChem CID 174248756) has the molecular formula C11H10Zr and a molecular weight of 233.43 g/mol. Its IUPAC name is benzene;cyclopenta-1,3-diene;zirconium(2+).
| Compound Name | benzene;cyclopenta-1,3-diene;zirconium(2+) |
|---|---|
| PubChem CID | 174248756 |
| Molecular Formula | C11H10Zr |
| Molecular Weight | 233.43 g/mol |
| Exact Mass | 231.98 |
| IUPAC Name | benzene;cyclopenta-1,3-diene;zirconium(2+) |
| SMILES | [C-]1=CC=CC1.[Zr+2].[c-]1ccccc1 |
| InChI | InChI=1S/C6H5.C5H5.Zr/c1-2-4-6-5-3-1;1-2-4-5-3-1;/h1-5H;1-3H,4H2;/q2*-1;+2 |
| InChIKey | HOUCGESDLPZSIN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|