C24H22N2O6S2 — CID 174251142
benzyl-[7-[benzyl(sulfo)amino]naphthalen-1-yl]sulfamic acid (PubChem CID 174251142) has the molecular formula C24H22N2O6S2 and a molecular weight of 498.58 g/mol. Its IUPAC name is benzyl-[7-[benzyl(sulfo)amino]naphthalen-1-yl]sulfamic acid.
| Compound Name | benzyl-[7-[benzyl(sulfo)amino]naphthalen-1-yl]sulfamic acid |
|---|---|
| PubChem CID | 174251142 |
| Molecular Formula | C24H22N2O6S2 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | benzyl-[7-[benzyl(sulfo)amino]naphthalen-1-yl]sulfamic acid |
| SMILES | O=S(=O)(O)N(Cc1ccccc1)c1ccc2cccc(N(Cc3ccccc3)S(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C24H22N2O6S2/c27-33(28,29)25(17-19-8-3-1-4-9-19)22-15-14-21-12-7-13-24(23(21)16-22)26(34(30,31)32)18-20-10-5-2-6-11-20/h1-16H,17-18H2,(H,27,28,29)(H,30,31,32) |
| InChIKey | LNWFNOMCYRLGFW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|