C10H18N2O3 — CID 174255725
1,4-dioxane;N-prop-2-enylprop-2-enehydrazide (PubChem CID 174255725) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is 1,4-dioxane;N-prop-2-enylprop-2-enehydrazide.
| Compound Name | 1,4-dioxane;N-prop-2-enylprop-2-enehydrazide |
|---|---|
| PubChem CID | 174255725 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 1,4-dioxane;N-prop-2-enylprop-2-enehydrazide |
| SMILES | C1COCCO1.C=CCN(N)C(=O)C=C |
| InChI | InChI=1S/C6H10N2O.C4H8O2/c1-3-5-8(7)6(9)4-2;1-2-6-4-3-5-1/h3-4H,1-2,5,7H2;1-4H2 |
| InChIKey | VIFFAHRWTDQEGJ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|