C12H12ClNO6 — CID 174259013
2-[(3R)-6-chloro-1-hydroxy-3-methyl-7-nitro-3,4-dihydroisochromen-1-yl]acetic acid (PubChem CID 174259013) has the molecular formula C12H12ClNO6 and a molecular weight of 301.68 g/mol. Its IUPAC name is 2-[(3R)-6-chloro-1-hydroxy-3-methyl-7-nitro-3,4-dihydroisochromen-1-yl]acetic acid.
| Compound Name | 2-[(3R)-6-chloro-1-hydroxy-3-methyl-7-nitro-3,4-dihydroisochromen-1-yl]acetic acid |
|---|---|
| PubChem CID | 174259013 |
| Molecular Formula | C12H12ClNO6 |
| Molecular Weight | 301.68 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 2-[(3R)-6-chloro-1-hydroxy-3-methyl-7-nitro-3,4-dihydroisochromen-1-yl]acetic acid |
| SMILES | C[C@@H]1Cc2cc(Cl)c([N+](=O)[O-])cc2C(O)(CC(=O)O)O1 |
| InChI | InChI=1S/C12H12ClNO6/c1-6-2-7-3-9(13)10(14(18)19)4-8(7)12(17,20-6)5-11(15)16/h3-4,6,17H,2,5H2,1H3,(H,15,16)/t6-,12?/m1/s1 |
| InChIKey | GWLFMIZTLFTQMP-ZJGHLTBISA-N |
| XLogP | 1.83 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.68 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|