C17H24N2O3 — CID 174264390
5-(3,5-ditert-butyl-4-hydroxyphenyl)-2,3-dihydro-1,3,4-oxadiazole-2-carbaldehyde (PubChem CID 174264390) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 5-(3,5-ditert-butyl-4-hydroxyphenyl)-2,3-dihydro-1,3,4-oxadiazole-2-carbaldehyde.
| Compound Name | 5-(3,5-ditert-butyl-4-hydroxyphenyl)-2,3-dihydro-1,3,4-oxadiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 174264390 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 5-(3,5-ditert-butyl-4-hydroxyphenyl)-2,3-dihydro-1,3,4-oxadiazole-2-carbaldehyde |
| SMILES | CC(C)(C)c1cc(C2=NNC(C=O)O2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C17H24N2O3/c1-16(2,3)11-7-10(15-19-18-13(9-20)22-15)8-12(14(11)21)17(4,5)6/h7-9,13,18,21H,1-6H3 |
| InChIKey | FWLLEGYXDCWIHA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|