C17H23NO2 — CID 173339981
2,6-ditert-butyl-4-(1,3-oxazol-4-yl)phenol (PubChem CID 173339981) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(1,3-oxazol-4-yl)phenol.
| Compound Name | 2,6-ditert-butyl-4-(1,3-oxazol-4-yl)phenol |
|---|---|
| PubChem CID | 173339981 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 2,6-ditert-butyl-4-(1,3-oxazol-4-yl)phenol |
| SMILES | CC(C)(C)c1cc(-c2cocn2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C17H23NO2/c1-16(2,3)12-7-11(14-9-20-10-18-14)8-13(15(12)19)17(4,5)6/h7-10,19H,1-6H3 |
| InChIKey | YWVLZXBXAVXPLN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |