C12H12F6N2O2 — CID 174271151
1-ethenylimidazole;1,1,2,4,4,4-hexafluorobutyl prop-2-enoate (PubChem CID 174271151) has the molecular formula C12H12F6N2O2 and a molecular weight of 330.23 g/mol. Its IUPAC name is 1-ethenylimidazole;1,1,2,4,4,4-hexafluorobutyl prop-2-enoate.
| Compound Name | 1-ethenylimidazole;1,1,2,4,4,4-hexafluorobutyl prop-2-enoate |
|---|---|
| PubChem CID | 174271151 |
| Molecular Formula | C12H12F6N2O2 |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 1-ethenylimidazole;1,1,2,4,4,4-hexafluorobutyl prop-2-enoate |
| SMILES | C=CC(=O)OC(F)(F)C(F)CC(F)(F)F.C=Cn1ccnc1 |
| InChI | InChI=1S/C7H6F6O2.C5H6N2/c1-2-5(14)15-7(12,13)4(8)3-6(9,10)11;1-2-7-4-3-6-5-7/h2,4H,1,3H2;2-5H,1H2 |
| InChIKey | UMMVMGQHIKBQMV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|