C36H51N5O6S — CID 174271214
tert-butyl N-[1-[3-[1-[[1-[3-cyano-4-[hydroxy(methoxy)methyl]phenyl]piperidin-4-yl]methyl]piperidin-4-yl]phenyl]sulfonylpiperidin-4-yl]carbamate (PubChem CID 174271214) has the molecular formula C36H51N5O6S and a molecular weight of 681.90 g/mol. Its IUPAC name is tert-butyl N-[1-[3-[1-[[1-[3-cyano-4-[hydroxy(methoxy)methyl]phenyl]piperidin-4-yl]methyl]piperidin-4-yl]phenyl]sulfonylpiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-[1-[[1-[3-cyano-4-[hydroxy(methoxy)methyl]phenyl]piperidin-4-yl]methyl]piperidin-4-yl]phenyl]sulfonylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 174271214 |
| Molecular Formula | C36H51N5O6S |
| Molecular Weight | 681.90 g/mol |
| Exact Mass | 681.36 |
| IUPAC Name | tert-butyl N-[1-[3-[1-[[1-[3-cyano-4-[hydroxy(methoxy)methyl]phenyl]piperidin-4-yl]methyl]piperidin-4-yl]phenyl]sulfonylpiperidin-4-yl]carbamate |
| SMILES | COC(O)c1ccc(N2CCC(CN3CCC(c4cccc(S(=O)(=O)N5CCC(NC(=O)OC(C)(C)C)CC5)c4)CC3)CC2)cc1C#N |
| InChI | InChI=1S/C36H51N5O6S/c1-36(2,3)47-35(43)38-30-14-20-41(21-15-30)48(44,45)32-7-5-6-28(23-32)27-12-16-39(17-13-27)25-26-10-18-40(19-11-26)31-8-9-33(34(42)46-4)29(22-31)24-37/h5-9,22-23,26-27,30,34,42H,10-21,25H2,1-4H3,(H,38,43) |
| InChIKey | OHISQYWTFJAJTP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.90 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|