C34H45N7O3S — CID 174271447
3-[4-[1-[1-[3-(4-aminopiperidin-1-yl)sulfanylphenyl]piperidin-4-yl]piperidin-4-yl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 174271447) has the molecular formula C34H45N7O3S and a molecular weight of 631.85 g/mol. Its IUPAC name is 3-[4-[1-[1-[3-(4-aminopiperidin-1-yl)sulfanylphenyl]piperidin-4-yl]piperidin-4-yl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[1-[1-[3-(4-aminopiperidin-1-yl)sulfanylphenyl]piperidin-4-yl]piperidin-4-yl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 174271447 |
| Molecular Formula | C34H45N7O3S |
| Molecular Weight | 631.85 g/mol |
| Exact Mass | 631.33 |
| IUPAC Name | 3-[4-[1-[1-[3-(4-aminopiperidin-1-yl)sulfanylphenyl]piperidin-4-yl]piperidin-4-yl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2cccc(C3CCN(C4CCN(c5cccc(SN6CCC(N)CC6)c5)CC4)CC3)c21 |
| InChI | InChI=1S/C34H45N7O3S/c1-37-32-28(6-3-7-29(32)41(34(37)44)30-8-9-31(42)36-33(30)43)23-10-16-38(17-11-23)25-14-18-39(19-15-25)26-4-2-5-27(22-26)45-40-20-12-24(35)13-21-40/h2-7,22-25,30H,8-21,35H2,1H3,(H,36,42,43) |
| InChIKey | XYXXMDPXCFPYRA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 108.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.85 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|